C17H19FN2OS — CID 8775433
(3-fluoro-4-methoxyphenyl)methyl N'-(2-phenylethyl)carbamimidothioate (PubChem CID 8775433) has the molecular formula C17H19FN2OS and a molecular weight of 318.42 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl N'-(2-phenylethyl)carbamimidothioate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl N'-(2-phenylethyl)carbamimidothioate |
|---|---|
| PubChem CID | 8775433 |
| Molecular Formula | C17H19FN2OS |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl N'-(2-phenylethyl)carbamimidothioate |
| SMILES | COc1ccc(CS/C(N)=N/CCc2ccccc2)cc1F |
| InChI | InChI=1S/C17H19FN2OS/c1-21-16-8-7-14(11-15(16)18)12-22-17(19)20-10-9-13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3,(H2,19,20) |
| InChIKey | CFMBRFXJLGUBTP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|