C13H19FN2OS — CID 8776605
(3-fluoro-4-methoxyphenyl)methyl N'-tert-butylcarbamimidothioate (PubChem CID 8776605) has the molecular formula C13H19FN2OS and a molecular weight of 270.37 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl N'-tert-butylcarbamimidothioate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl N'-tert-butylcarbamimidothioate |
|---|---|
| PubChem CID | 8776605 |
| Molecular Formula | C13H19FN2OS |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl N'-tert-butylcarbamimidothioate |
| SMILES | COc1ccc(CS/C(N)=N/C(C)(C)C)cc1F |
| InChI | InChI=1S/C13H19FN2OS/c1-13(2,3)16-12(15)18-8-9-5-6-11(17-4)10(14)7-9/h5-7H,8H2,1-4H3,(H2,15,16) |
| InChIKey | FKLGELXHTIPMNY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|