C22H27FO4 — CID 174590330
6-(3-fluoro-4-methoxyphenyl)-2-hydroxy-4-methyl-2-(2-phenylethyl)hexanoic acid (PubChem CID 174590330) has the molecular formula C22H27FO4 and a molecular weight of 374.45 g/mol. Its IUPAC name is 6-(3-fluoro-4-methoxyphenyl)-2-hydroxy-4-methyl-2-(2-phenylethyl)hexanoic acid.
| Compound Name | 6-(3-fluoro-4-methoxyphenyl)-2-hydroxy-4-methyl-2-(2-phenylethyl)hexanoic acid |
|---|---|
| PubChem CID | 174590330 |
| Molecular Formula | C22H27FO4 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 6-(3-fluoro-4-methoxyphenyl)-2-hydroxy-4-methyl-2-(2-phenylethyl)hexanoic acid |
| SMILES | COc1ccc(CCC(C)CC(O)(CCc2ccccc2)C(=O)O)cc1F |
| InChI | InChI=1S/C22H27FO4/c1-16(8-9-18-10-11-20(27-2)19(23)14-18)15-22(26,21(24)25)13-12-17-6-4-3-5-7-17/h3-7,10-11,14,16,26H,8-9,12-13,15H2,1-2H3,(H,24,25) |
| InChIKey | DHGUUDMJFUTHKZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |