C23H29FN2O3 — CID 21282395
N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide (PubChem CID 21282395) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide.
| Compound Name | N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide |
|---|---|
| PubChem CID | 21282395 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide |
| SMILES | COc1ccc(CCNC(=O)CCCCC(=O)NCCc2ccccc2)cc1F |
| InChI | InChI=1S/C23H29FN2O3/c1-29-21-12-11-19(17-20(21)24)14-16-26-23(28)10-6-5-9-22(27)25-15-13-18-7-3-2-4-8-18/h2-4,7-8,11-12,17H,5-6,9-10,13-16H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | ORUZGMDEBSHLJH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|