C15H25NO4Si — CID 174613430
N-(2-phenylethyl)-4-trimethoxysilylbutanamide (PubChem CID 174613430) has the molecular formula C15H25NO4Si and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(2-phenylethyl)-4-trimethoxysilylbutanamide.
| Compound Name | N-(2-phenylethyl)-4-trimethoxysilylbutanamide |
|---|---|
| PubChem CID | 174613430 |
| Molecular Formula | C15H25NO4Si |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-(2-phenylethyl)-4-trimethoxysilylbutanamide |
| SMILES | CO[Si](CCCC(=O)NCCc1ccccc1)(OC)OC |
| InChI | InChI=1S/C15H25NO4Si/c1-18-21(19-2,20-3)13-7-10-15(17)16-12-11-14-8-5-4-6-9-14/h4-6,8-9H,7,10-13H2,1-3H3,(H,16,17) |
| InChIKey | QSNPRDVSNPIJMY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|