C24H31FN2O4 — CID 19838083
N'-[2-(3-fluoro-4,5-dimethoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide (PubChem CID 19838083) has the molecular formula C24H31FN2O4 and a molecular weight of 430.52 g/mol. Its IUPAC name is N'-[2-(3-fluoro-4,5-dimethoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide.
| Compound Name | N'-[2-(3-fluoro-4,5-dimethoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide |
|---|---|
| PubChem CID | 19838083 |
| Molecular Formula | C24H31FN2O4 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N'-[2-(3-fluoro-4,5-dimethoxyphenyl)ethyl]-N-(2-phenylethyl)hexanediamide |
| SMILES | COc1cc(CCNC(=O)CCCCC(=O)NCCc2ccccc2)cc(F)c1OC |
| InChI | InChI=1S/C24H31FN2O4/c1-30-21-17-19(16-20(25)24(21)31-2)13-15-27-23(29)11-7-6-10-22(28)26-14-12-18-8-4-3-5-9-18/h3-5,8-9,16-17H,6-7,10-15H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | FWWGFRAXROEEBV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|