C34H44N2O6 — CID 23043900
N'-[2-[2-[2-(3,5-dimethoxyphenyl)ethyl]-3,4-dimethoxyphenyl]ethyl]-N-(2-phenylethyl)hexanediamide (PubChem CID 23043900) has the molecular formula C34H44N2O6 and a molecular weight of 576.73 g/mol. Its IUPAC name is N'-[2-[2-[2-(3,5-dimethoxyphenyl)ethyl]-3,4-dimethoxyphenyl]ethyl]-N-(2-phenylethyl)hexanediamide.
| Compound Name | N'-[2-[2-[2-(3,5-dimethoxyphenyl)ethyl]-3,4-dimethoxyphenyl]ethyl]-N-(2-phenylethyl)hexanediamide |
|---|---|
| PubChem CID | 23043900 |
| Molecular Formula | C34H44N2O6 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | N'-[2-[2-[2-(3,5-dimethoxyphenyl)ethyl]-3,4-dimethoxyphenyl]ethyl]-N-(2-phenylethyl)hexanediamide |
| SMILES | COc1cc(CCc2c(CCNC(=O)CCCCC(=O)NCCc3ccccc3)ccc(OC)c2OC)cc(OC)c1 |
| InChI | InChI=1S/C34H44N2O6/c1-39-28-22-26(23-29(24-28)40-2)14-16-30-27(15-17-31(41-3)34(30)42-4)19-21-36-33(38)13-9-8-12-32(37)35-20-18-25-10-6-5-7-11-25/h5-7,10-11,15,17,22-24H,8-9,12-14,16,18-21H2,1-4H3,(H,35,37)(H,36,38) |
| InChIKey | LSPLCPRRNNZPLG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|