C34H48N2O4 — CID 23044051
N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]-N-[2-(3-methoxyphenyl)ethyl]hexane-1,6-diamine (PubChem CID 23044051) has the molecular formula C34H48N2O4 and a molecular weight of 548.77 g/mol. Its IUPAC name is N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]-N-[2-(3-methoxyphenyl)ethyl]hexane-1,6-diamine.
| Compound Name | N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]-N-[2-(3-methoxyphenyl)ethyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 23044051 |
| Molecular Formula | C34H48N2O4 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]-N-[2-(3-methoxyphenyl)ethyl]hexane-1,6-diamine |
| SMILES | COc1cccc(CCNCCCCCCNCCc2ccc(OC)c(OC)c2CCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C34H48N2O4/c1-37-30-13-9-11-27(25-30)15-17-32-29(16-18-33(39-3)34(32)40-4)20-24-36-22-8-6-5-7-21-35-23-19-28-12-10-14-31(26-28)38-2/h9-14,16,18,25-26,35-36H,5-8,15,17,19-24H2,1-4H3 |
| InChIKey | RYCACJLOQUFPAI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|