C13H17NO — CID 103846287
N-[2-(3-methoxyphenyl)ethyl]but-3-yn-1-amine (PubChem CID 103846287) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)ethyl]but-3-yn-1-amine.
| Compound Name | N-[2-(3-methoxyphenyl)ethyl]but-3-yn-1-amine |
|---|---|
| PubChem CID | 103846287 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-[2-(3-methoxyphenyl)ethyl]but-3-yn-1-amine |
| SMILES | C#CCCNCCc1cccc(OC)c1 |
| InChI | InChI=1S/C13H17NO/c1-3-4-9-14-10-8-12-6-5-7-13(11-12)15-2/h1,5-7,11,14H,4,8-10H2,2H3 |
| InChIKey | GWUXHWDZNGIIDL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|