C16H27NO3 — CID 107852059
3,3-diethoxy-N-[2-(3-methoxyphenyl)ethyl]propan-1-amine (PubChem CID 107852059) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3,3-diethoxy-N-[2-(3-methoxyphenyl)ethyl]propan-1-amine.
| Compound Name | 3,3-diethoxy-N-[2-(3-methoxyphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107852059 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 3,3-diethoxy-N-[2-(3-methoxyphenyl)ethyl]propan-1-amine |
| SMILES | CCOC(CCNCCc1cccc(OC)c1)OCC |
| InChI | InChI=1S/C16H27NO3/c1-4-19-16(20-5-2)10-12-17-11-9-14-7-6-8-15(13-14)18-3/h6-8,13,16-17H,4-5,9-12H2,1-3H3 |
| InChIKey | LGWWWPOYVWKKCA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|