C15H24O4 — CID 101485664
1,1-diethoxy-4-(3-methoxyphenyl)butan-2-ol (PubChem CID 101485664) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1,1-diethoxy-4-(3-methoxyphenyl)butan-2-ol.
| Compound Name | 1,1-diethoxy-4-(3-methoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 101485664 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1,1-diethoxy-4-(3-methoxyphenyl)butan-2-ol |
| SMILES | CCOC(OCC)C(O)CCc1cccc(OC)c1 |
| InChI | InChI=1S/C15H24O4/c1-4-18-15(19-5-2)14(16)10-9-12-7-6-8-13(11-12)17-3/h6-8,11,14-16H,4-5,9-10H2,1-3H3 |
| InChIKey | OKOTYNZTXXSCOT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|