C22H28O3 — CID 67187832
ethyl 2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoate (PubChem CID 67187832) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is ethyl 2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoate.
| Compound Name | ethyl 2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 67187832 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | ethyl 2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoate |
| SMILES | CCOC(=O)C(CCCc1ccccc1)CCc1cccc(OC)c1 |
| InChI | InChI=1S/C22H28O3/c1-3-25-22(23)20(13-7-11-18-9-5-4-6-10-18)16-15-19-12-8-14-21(17-19)24-2/h4-6,8-10,12,14,17,20H,3,7,11,13,15-16H2,1-2H3 |
| InChIKey | QJEBZOJRLAEVLV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |