C19H22O4 — CID 11781998
(2R,3R)-2,3-dihydroxy-1-(3-methoxyphenyl)-6-phenylhexan-1-one (PubChem CID 11781998) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-1-(3-methoxyphenyl)-6-phenylhexan-1-one.
| Compound Name | (2R,3R)-2,3-dihydroxy-1-(3-methoxyphenyl)-6-phenylhexan-1-one |
|---|---|
| PubChem CID | 11781998 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-1-(3-methoxyphenyl)-6-phenylhexan-1-one |
| SMILES | COc1cccc(C(=O)[C@H](O)[C@H](O)CCCc2ccccc2)c1 |
| InChI | InChI=1S/C19H22O4/c1-23-16-11-6-10-15(13-16)18(21)19(22)17(20)12-5-9-14-7-3-2-4-8-14/h2-4,6-8,10-11,13,17,19-20,22H,5,9,12H2,1H3/t17-,19-/m1/s1 |
| InChIKey | JBXGHHOCIOESJJ-IEBWSBKVSA-N |
| XLogP | 2.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |