C39H44O5 — CID 90874976
[2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoyl] 2-[2-(3-hydroxyphenyl)ethyl]-5-phenylpentanoate (PubChem CID 90874976) has the molecular formula C39H44O5 and a molecular weight of 592.78 g/mol. Its IUPAC name is [2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoyl] 2-[2-(3-hydroxyphenyl)ethyl]-5-phenylpentanoate.
| Compound Name | [2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoyl] 2-[2-(3-hydroxyphenyl)ethyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 90874976 |
| Molecular Formula | C39H44O5 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | [2-[2-(3-methoxyphenyl)ethyl]-5-phenylpentanoyl] 2-[2-(3-hydroxyphenyl)ethyl]-5-phenylpentanoate |
| SMILES | COc1cccc(CCC(CCCc2ccccc2)C(=O)OC(=O)C(CCCc2ccccc2)CCc2cccc(O)c2)c1 |
| InChI | InChI=1S/C39H44O5/c1-43-37-23-11-19-33(29-37)25-27-35(21-9-17-31-14-6-3-7-15-31)39(42)44-38(41)34(20-8-16-30-12-4-2-5-13-30)26-24-32-18-10-22-36(40)28-32/h2-7,10-15,18-19,22-23,28-29,34-35,40H,8-9,16-17,20-21,24-27H2,1H3 |
| InChIKey | PLXMYYKEJXQXBJ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|