C16H25NO3 — CID 53241285
(3S,5R)-3-(aminomethyl)-7-(3-methoxyphenyl)-5-methylheptanoic acid (PubChem CID 53241285) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (3S,5R)-3-(aminomethyl)-7-(3-methoxyphenyl)-5-methylheptanoic acid.
| Compound Name | (3S,5R)-3-(aminomethyl)-7-(3-methoxyphenyl)-5-methylheptanoic acid |
|---|---|
| PubChem CID | 53241285 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (3S,5R)-3-(aminomethyl)-7-(3-methoxyphenyl)-5-methylheptanoic acid |
| SMILES | COc1cccc(CC[C@@H](C)C[C@H](CN)CC(=O)O)c1 |
| InChI | InChI=1S/C16H25NO3/c1-12(8-14(11-17)10-16(18)19)6-7-13-4-3-5-15(9-13)20-2/h3-5,9,12,14H,6-8,10-11,17H2,1-2H3,(H,18,19)/t12-,14+/m1/s1 |
| InChIKey | SNRGQBQIBPMKAD-OCCSQVGLSA-N |
| XLogP | 2.70 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |