C14H17F3O3 — CID 68539848
6,6,6-trifluoro-3-[(3-methoxyphenyl)methyl]hexanoic acid (PubChem CID 68539848) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 6,6,6-trifluoro-3-[(3-methoxyphenyl)methyl]hexanoic acid.
| Compound Name | 6,6,6-trifluoro-3-[(3-methoxyphenyl)methyl]hexanoic acid |
|---|---|
| PubChem CID | 68539848 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 6,6,6-trifluoro-3-[(3-methoxyphenyl)methyl]hexanoic acid |
| SMILES | COc1cccc(CC(CCC(F)(F)F)CC(=O)O)c1 |
| InChI | InChI=1S/C14H17F3O3/c1-20-12-4-2-3-10(8-12)7-11(9-13(18)19)5-6-14(15,16)17/h2-4,8,11H,5-7,9H2,1H3,(H,18,19) |
| InChIKey | FFYIFGBCGYOIKA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |