C16H25BrO — CID 66041331
1-[2-(bromomethyl)-5,5-dimethylhexyl]-3-methoxybenzene (PubChem CID 66041331) has the molecular formula C16H25BrO and a molecular weight of 313.28 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5,5-dimethylhexyl]-3-methoxybenzene.
| Compound Name | 1-[2-(bromomethyl)-5,5-dimethylhexyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 66041331 |
| Molecular Formula | C16H25BrO |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[2-(bromomethyl)-5,5-dimethylhexyl]-3-methoxybenzene |
| SMILES | COc1cccc(CC(CBr)CCC(C)(C)C)c1 |
| InChI | InChI=1S/C16H25BrO/c1-16(2,3)9-8-14(12-17)10-13-6-5-7-15(11-13)18-4/h5-7,11,14H,8-10,12H2,1-4H3 |
| InChIKey | USOXRQBDZWFRBY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|