C15H16BrClOS — CID 66043340
2-[2-(bromomethyl)-3-(3-methoxyphenyl)propyl]-5-chlorothiophene (PubChem CID 66043340) has the molecular formula C15H16BrClOS and a molecular weight of 359.72 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-(3-methoxyphenyl)propyl]-5-chlorothiophene.
| Compound Name | 2-[2-(bromomethyl)-3-(3-methoxyphenyl)propyl]-5-chlorothiophene |
|---|---|
| PubChem CID | 66043340 |
| Molecular Formula | C15H16BrClOS |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-[2-(bromomethyl)-3-(3-methoxyphenyl)propyl]-5-chlorothiophene |
| SMILES | COc1cccc(CC(CBr)Cc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C15H16BrClOS/c1-18-13-4-2-3-11(8-13)7-12(10-16)9-14-5-6-15(17)19-14/h2-6,8,12H,7,9-10H2,1H3 |
| InChIKey | BXZBMEBCJGOQGA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|