C16H25BrO3S — CID 106734632
1-[2-(bromomethyl)-4-tert-butylsulfonylbutyl]-3-methoxybenzene (PubChem CID 106734632) has the molecular formula C16H25BrO3S and a molecular weight of 377.34 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-tert-butylsulfonylbutyl]-3-methoxybenzene.
| Compound Name | 1-[2-(bromomethyl)-4-tert-butylsulfonylbutyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 106734632 |
| Molecular Formula | C16H25BrO3S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-[2-(bromomethyl)-4-tert-butylsulfonylbutyl]-3-methoxybenzene |
| SMILES | COc1cccc(CC(CBr)CCS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H25BrO3S/c1-16(2,3)21(18,19)9-8-14(12-17)10-13-6-5-7-15(11-13)20-4/h5-7,11,14H,8-10,12H2,1-4H3 |
| InChIKey | GBSDAUGAQOFSPC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|