C13H19ClO3S — CID 66048810
1-[2-(chloromethyl)-4-methylsulfonylbutyl]-3-methoxybenzene (PubChem CID 66048810) has the molecular formula C13H19ClO3S and a molecular weight of 290.81 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-4-methylsulfonylbutyl]-3-methoxybenzene.
| Compound Name | 1-[2-(chloromethyl)-4-methylsulfonylbutyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 66048810 |
| Molecular Formula | C13H19ClO3S |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-[2-(chloromethyl)-4-methylsulfonylbutyl]-3-methoxybenzene |
| SMILES | COc1cccc(CC(CCl)CCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H19ClO3S/c1-17-13-5-3-4-11(9-13)8-12(10-14)6-7-18(2,15)16/h3-5,9,12H,6-8,10H2,1-2H3 |
| InChIKey | FWXVKQPRXYTDPY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|