C14H21ClO3S — CID 66048149
1-[2-(chloromethyl)-5-methylsulfonylpentyl]-3-methoxybenzene (PubChem CID 66048149) has the molecular formula C14H21ClO3S and a molecular weight of 304.84 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-5-methylsulfonylpentyl]-3-methoxybenzene.
| Compound Name | 1-[2-(chloromethyl)-5-methylsulfonylpentyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 66048149 |
| Molecular Formula | C14H21ClO3S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[2-(chloromethyl)-5-methylsulfonylpentyl]-3-methoxybenzene |
| SMILES | COc1cccc(CC(CCl)CCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H21ClO3S/c1-18-14-7-3-5-12(10-14)9-13(11-15)6-4-8-19(2,16)17/h3,5,7,10,13H,4,6,8-9,11H2,1-2H3 |
| InChIKey | JVCWAGWBABQQRM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|