C14H22O4S — CID 65095333
5-ethylsulfonyl-1-(3-methoxyphenyl)pentan-2-ol (PubChem CID 65095333) has the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. Its IUPAC name is 5-ethylsulfonyl-1-(3-methoxyphenyl)pentan-2-ol.
| Compound Name | 5-ethylsulfonyl-1-(3-methoxyphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 65095333 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 5-ethylsulfonyl-1-(3-methoxyphenyl)pentan-2-ol |
| SMILES | CCS(=O)(=O)CCCC(O)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C14H22O4S/c1-3-19(16,17)9-5-7-13(15)10-12-6-4-8-14(11-12)18-2/h4,6,8,11,13,15H,3,5,7,9-10H2,1-2H3 |
| InChIKey | YIHOVYRJDGZGNP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |