C13H18Cl2O3S — CID 65095539
1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-ol (PubChem CID 65095539) has the molecular formula C13H18Cl2O3S and a molecular weight of 325.26 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-ol.
| Compound Name | 1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-ol |
|---|---|
| PubChem CID | 65095539 |
| Molecular Formula | C13H18Cl2O3S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-ol |
| SMILES | CCS(=O)(=O)CCCC(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H18Cl2O3S/c1-2-19(17,18)8-4-5-10(16)9-11-12(14)6-3-7-13(11)15/h3,6-7,10,16H,2,4-5,8-9H2,1H3 |
| InChIKey | OJHAGRKOFVWERO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |