C10H12Cl2O3S — CID 115601600
1-(2,6-dichlorophenyl)-3-methylsulfonylpropan-2-ol (PubChem CID 115601600) has the molecular formula C10H12Cl2O3S and a molecular weight of 283.18 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-methylsulfonylpropan-2-ol.
| Compound Name | 1-(2,6-dichlorophenyl)-3-methylsulfonylpropan-2-ol |
|---|---|
| PubChem CID | 115601600 |
| Molecular Formula | C10H12Cl2O3S |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-methylsulfonylpropan-2-ol |
| SMILES | CS(=O)(=O)CC(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H12Cl2O3S/c1-16(14,15)6-7(13)5-8-9(11)3-2-4-10(8)12/h2-4,7,13H,5-6H2,1H3 |
| InChIKey | KYNLJQYBSNVQBW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |