C16H16Cl2OS — CID 66097992
1-(2,6-dichlorophenyl)-3-(2-methylphenyl)sulfanylpropan-2-ol (PubChem CID 66097992) has the molecular formula C16H16Cl2OS and a molecular weight of 327.28 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-(2-methylphenyl)sulfanylpropan-2-ol.
| Compound Name | 1-(2,6-dichlorophenyl)-3-(2-methylphenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 66097992 |
| Molecular Formula | C16H16Cl2OS |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-(2-methylphenyl)sulfanylpropan-2-ol |
| SMILES | Cc1ccccc1SCC(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H16Cl2OS/c1-11-5-2-3-8-16(11)20-10-12(19)9-13-14(17)6-4-7-15(13)18/h2-8,12,19H,9-10H2,1H3 |
| InChIKey | RSIDCXBLBMGSID-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |