C9H11ClO2S — CID 78912037
3-(2-chlorophenyl)sulfanylpropane-1,2-diol (PubChem CID 78912037) has the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. Its IUPAC name is 3-(2-chlorophenyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(2-chlorophenyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 78912037 |
| Molecular Formula | C9H11ClO2S |
| Molecular Weight | 218.70 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 3-(2-chlorophenyl)sulfanylpropane-1,2-diol |
| SMILES | OCC(O)CSc1ccccc1Cl |
| InChI | InChI=1S/C9H11ClO2S/c10-8-3-1-2-4-9(8)13-6-7(12)5-11/h1-4,7,11-12H,5-6H2 |
| InChIKey | XSLAEIMMKBODGK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.70 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |