C12H18O3S — CID 103960852
3-[2-[(1R)-1-hydroxypropyl]phenyl]sulfanylpropane-1,2-diol (PubChem CID 103960852) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-[2-[(1R)-1-hydroxypropyl]phenyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[2-[(1R)-1-hydroxypropyl]phenyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 103960852 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-[2-[(1R)-1-hydroxypropyl]phenyl]sulfanylpropane-1,2-diol |
| SMILES | CC[C@@H](O)c1ccccc1SCC(O)CO |
| InChI | InChI=1S/C12H18O3S/c1-2-11(15)10-5-3-4-6-12(10)16-8-9(14)7-13/h3-6,9,11,13-15H,2,7-8H2,1H3/t9?,11-/m1/s1 |
| InChIKey | BDRYTDKFTBTWOO-HCCKASOXSA-N |
| XLogP | 1.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |