C12H18O2S — CID 103960848
(1R)-1-[2-(3-hydroxypropylsulfanyl)phenyl]propan-1-ol (PubChem CID 103960848) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is (1R)-1-[2-(3-hydroxypropylsulfanyl)phenyl]propan-1-ol.
| Compound Name | (1R)-1-[2-(3-hydroxypropylsulfanyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 103960848 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (1R)-1-[2-(3-hydroxypropylsulfanyl)phenyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccccc1SCCCO |
| InChI | InChI=1S/C12H18O2S/c1-2-11(14)10-6-3-4-7-12(10)15-9-5-8-13/h3-4,6-7,11,13-14H,2,5,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | FMNVMRQZTPHJCZ-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|