C9H12ClNO2S — CID 79681822
3-(2-amino-6-chlorophenyl)sulfanylpropane-1,2-diol (PubChem CID 79681822) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is 3-(2-amino-6-chlorophenyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(2-amino-6-chlorophenyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79681822 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 3-(2-amino-6-chlorophenyl)sulfanylpropane-1,2-diol |
| SMILES | Nc1cccc(Cl)c1SCC(O)CO |
| InChI | InChI=1S/C9H12ClNO2S/c10-7-2-1-3-8(11)9(7)14-5-6(13)4-12/h1-3,6,12-13H,4-5,11H2 |
| InChIKey | ZOJSQBLMGMXFPY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|