C11H15NO4S — CID 112580224
methyl 3-amino-2-(2,3-dihydroxypropylsulfanyl)benzoate (PubChem CID 112580224) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is methyl 3-amino-2-(2,3-dihydroxypropylsulfanyl)benzoate.
| Compound Name | methyl 3-amino-2-(2,3-dihydroxypropylsulfanyl)benzoate |
|---|---|
| PubChem CID | 112580224 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 3-amino-2-(2,3-dihydroxypropylsulfanyl)benzoate |
| SMILES | COC(=O)c1cccc(N)c1SCC(O)CO |
| InChI | InChI=1S/C11H15NO4S/c1-16-11(15)8-3-2-4-9(12)10(8)17-6-7(14)5-13/h2-4,7,13-14H,5-6,12H2,1H3 |
| InChIKey | KUPSRCFETHYQIB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|