C11H15NO5 — CID 168597109
methyl 3-(2,3-dihydroxypropylamino)-2-hydroxybenzoate (PubChem CID 168597109) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is methyl 3-(2,3-dihydroxypropylamino)-2-hydroxybenzoate.
| Compound Name | methyl 3-(2,3-dihydroxypropylamino)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 168597109 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | methyl 3-(2,3-dihydroxypropylamino)-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NCC(O)CO)c1O |
| InChI | InChI=1S/C11H15NO5/c1-17-11(16)8-3-2-4-9(10(8)15)12-5-7(14)6-13/h2-4,7,12-15H,5-6H2,1H3 |
| InChIKey | YWIALYIEIFLLIS-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|