C11H16N2O3 — CID 168596792
N-[2-(2,3-dihydroxypropylamino)phenyl]acetamide (PubChem CID 168596792) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[2-(2,3-dihydroxypropylamino)phenyl]acetamide.
| Compound Name | N-[2-(2,3-dihydroxypropylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 168596792 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[2-(2,3-dihydroxypropylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1NCC(O)CO |
| InChI | InChI=1S/C11H16N2O3/c1-8(15)13-11-5-3-2-4-10(11)12-6-9(16)7-14/h2-5,9,12,14,16H,6-7H2,1H3,(H,13,15) |
| InChIKey | PXHBGVNVDSBJEM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |