C11H14BrNO3 — CID 168594040
1-[4-bromo-3-(2,3-dihydroxypropylamino)phenyl]ethanone (PubChem CID 168594040) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 1-[4-bromo-3-(2,3-dihydroxypropylamino)phenyl]ethanone.
| Compound Name | 1-[4-bromo-3-(2,3-dihydroxypropylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 168594040 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1-[4-bromo-3-(2,3-dihydroxypropylamino)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Br)c(NCC(O)CO)c1 |
| InChI | InChI=1S/C11H14BrNO3/c1-7(15)8-2-3-10(12)11(4-8)13-5-9(16)6-14/h2-4,9,13-14,16H,5-6H2,1H3 |
| InChIKey | QWOMDZGYTJGFMH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |