C11H16O5 — CID 174948950
1-(4-hydroxyphenyl)ethanone;propane-1,2,3-triol (PubChem CID 174948950) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)ethanone;propane-1,2,3-triol.
| Compound Name | 1-(4-hydroxyphenyl)ethanone;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174948950 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-(4-hydroxyphenyl)ethanone;propane-1,2,3-triol |
| SMILES | CC(=O)c1ccc(O)cc1.OCC(O)CO |
| InChI | InChI=1S/C8H8O2.C3H8O3/c1-6(9)7-2-4-8(10)5-3-7;4-1-3(6)2-5/h2-5,10H,1H3;3-6H,1-2H2 |
| InChIKey | JTNLFSKPGBZOTI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |