C12H16N2O4 — CID 66175411
1-(4-acetylphenyl)-3-(2,3-dihydroxypropyl)urea (PubChem CID 66175411) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-(2,3-dihydroxypropyl)urea.
| Compound Name | 1-(4-acetylphenyl)-3-(2,3-dihydroxypropyl)urea |
|---|---|
| PubChem CID | 66175411 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-(4-acetylphenyl)-3-(2,3-dihydroxypropyl)urea |
| SMILES | CC(=O)c1ccc(NC(=O)NCC(O)CO)cc1 |
| InChI | InChI=1S/C12H16N2O4/c1-8(16)9-2-4-10(5-3-9)14-12(18)13-6-11(17)7-15/h2-5,11,15,17H,6-7H2,1H3,(H2,13,14,18) |
| InChIKey | KIIVWDQHTWEWPQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |