C10H12Cl2N2O3 — CID 40653606
1-(3,4-dichlorophenyl)-3-[(2S)-2,3-dihydroxypropyl]urea (PubChem CID 40653606) has the molecular formula C10H12Cl2N2O3 and a molecular weight of 279.12 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(2S)-2,3-dihydroxypropyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(2S)-2,3-dihydroxypropyl]urea |
|---|---|
| PubChem CID | 40653606 |
| Molecular Formula | C10H12Cl2N2O3 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(2S)-2,3-dihydroxypropyl]urea |
| SMILES | O=C(NC[C@H](O)CO)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O3/c11-8-2-1-6(3-9(8)12)14-10(17)13-4-7(16)5-15/h1-3,7,15-16H,4-5H2,(H2,13,14,17)/t7-/m0/s1 |
| InChIKey | VVMZECMDVYRBDC-ZETCQYMHSA-N |
| XLogP | 1.47 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |