C10H12Cl2N2O2 — CID 43417317
1-(3,4-dichlorophenyl)-3-(1-hydroxypropan-2-yl)urea (PubChem CID 43417317) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(1-hydroxypropan-2-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 43417317 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(1-hydroxypropan-2-yl)urea |
| SMILES | CC(CO)NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O2/c1-6(5-15)13-10(16)14-7-2-3-8(11)9(12)4-7/h2-4,6,15H,5H2,1H3,(H2,13,14,16) |
| InChIKey | BPYAQISMHRJFOH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |