C12H18N2O2 — CID 110890307
1-(3,4-dimethylphenyl)-3-(1-hydroxypropan-2-yl)urea (PubChem CID 110890307) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(1-hydroxypropan-2-yl)urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 110890307 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(1-hydroxypropan-2-yl)urea |
| SMILES | Cc1ccc(NC(=O)NC(C)CO)cc1C |
| InChI | InChI=1S/C12H18N2O2/c1-8-4-5-11(6-9(8)2)14-12(16)13-10(3)7-15/h4-6,10,15H,7H2,1-3H3,(H2,13,14,16) |
| InChIKey | IIQYBSGDMSKKHM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |