5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid

C13H16Cl2N2O3 — CID 82854342

IUPAC5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid
SMILESCC(CCCC(=O)O)NC(=O)Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H16Cl2N2O3/c1-8(3-2-4-12(18)19)16-13(20)17-9-5-6-10(14)11(15)7-9/h5-8H,2-4H2,1H3,(H,18,19)(H2,16,17,20)
InChIKeyJFHZBHPPOQMRFQ-UHFFFAOYSA-N
MW319.19 g/mol
LogP3.76
Rot. Bonds6

About 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid

5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid (PubChem CID 82854342) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid.

Molecular Properties

Compound Name5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid
PubChem CID82854342
Molecular FormulaC13H16Cl2N2O3
Molecular Weight319.19 g/mol
Exact Mass318.05
IUPAC Name5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid
SMILESCC(CCCC(=O)O)NC(=O)Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H16Cl2N2O3/c1-8(3-2-4-12(18)19)16-13(20)17-9-5-6-10(14)11(15)7-9/h5-8H,2-4H2,1H3,(H,18,19)(H2,16,17,20)
InChIKeyJFHZBHPPOQMRFQ-UHFFFAOYSA-N
XLogP3.76
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.19
LogP ≤ 53.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid?
The IUPAC name of 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid (CID 82854342) is 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid.
What is the SMILES notation for 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid?
The canonical SMILES for 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid is CC(CCCC(=O)O)NC(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid?
The InChIKey is JFHZBHPPOQMRFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2N2O3/c1-8(3-2-4-12(18)19)16-13(20)17-9-5-6-10(14)11(15)7-9/h5-8H,2-4H2,1H3,(H,18,19)(H2,16,17,20).
What are the key properties of 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid?
5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid has a molecular weight of 319.19 g/mol, XLogP of 3.76, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dichlorophenyl)carbamoylamino]hexanoic acid is sourced from PubChem (CID 82854342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).