C15H22Cl2N2O — CID 102916216
1-(3,4-dichlorophenyl)-3-(3-methyl-2-propan-2-ylbutyl)urea (PubChem CID 102916216) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(3-methyl-2-propan-2-ylbutyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(3-methyl-2-propan-2-ylbutyl)urea |
|---|---|
| PubChem CID | 102916216 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(3-methyl-2-propan-2-ylbutyl)urea |
| SMILES | CC(C)C(CNC(=O)Nc1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C15H22Cl2N2O/c1-9(2)12(10(3)4)8-18-15(20)19-11-5-6-13(16)14(17)7-11/h5-7,9-10,12H,8H2,1-4H3,(H2,18,19,20) |
| InChIKey | DHVTXFCWKGTWEM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |