C17H14Cl2N2O3 — CID 131701819
1-[2,2-bis(furan-2-yl)ethyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 131701819) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is 1-[2,2-bis(furan-2-yl)ethyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[2,2-bis(furan-2-yl)ethyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 131701819 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-[2,2-bis(furan-2-yl)ethyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NCC(c1ccco1)c1ccco1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c18-13-6-5-11(9-14(13)19)21-17(22)20-10-12(15-3-1-7-23-15)16-4-2-8-24-16/h1-9,12H,10H2,(H2,20,21,22) |
| InChIKey | LLHDNHCOOBAFJX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |