C14H14Cl2N2O3 — CID 121145780
1-(3,4-dichlorophenyl)-3-[2-(furan-2-yl)-2-methoxyethyl]urea (PubChem CID 121145780) has the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(furan-2-yl)-2-methoxyethyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(furan-2-yl)-2-methoxyethyl]urea |
|---|---|
| PubChem CID | 121145780 |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(furan-2-yl)-2-methoxyethyl]urea |
| SMILES | COC(CNC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C14H14Cl2N2O3/c1-20-13(12-3-2-6-21-12)8-17-14(19)18-9-4-5-10(15)11(16)7-9/h2-7,13H,8H2,1H3,(H2,17,18,19) |
| InChIKey | NHCBNPZUKMMMEI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |