C14H14Cl2N2O2 — CID 8917918
N-(3,4-dichlorophenyl)-2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetamide (PubChem CID 8917918) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 8917918 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetamide |
| SMILES | C[C@H](NCC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-9(13-3-2-6-20-13)17-8-14(19)18-10-4-5-11(15)12(16)7-10/h2-7,9,17H,8H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | PWNHMJAMJSLNLX-VIFPVBQESA-N |
| XLogP | 3.88 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |