C13H13Cl2NO — CID 81403339
(1S)-N-[(3,4-dichlorophenyl)methyl]-1-(furan-2-yl)ethanamine (PubChem CID 81403339) has the molecular formula C13H13Cl2NO and a molecular weight of 270.16 g/mol. Its IUPAC name is (1S)-N-[(3,4-dichlorophenyl)methyl]-1-(furan-2-yl)ethanamine.
| Compound Name | (1S)-N-[(3,4-dichlorophenyl)methyl]-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 81403339 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (1S)-N-[(3,4-dichlorophenyl)methyl]-1-(furan-2-yl)ethanamine |
| SMILES | C[C@H](NCc1ccc(Cl)c(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C13H13Cl2NO/c1-9(13-3-2-6-17-13)16-8-10-4-5-11(14)12(15)7-10/h2-7,9,16H,8H2,1H3/t9-/m0/s1 |
| InChIKey | UYPZRHOESNYDTK-VIFPVBQESA-N |
| XLogP | 4.44 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |