C18H28N2O7 — CID 153358045
5-acetyl-1-N,3-N-bis(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide;ethane (PubChem CID 153358045) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is 5-acetyl-1-N,3-N-bis(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide;ethane.
| Compound Name | 5-acetyl-1-N,3-N-bis(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide;ethane |
|---|---|
| PubChem CID | 153358045 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 5-acetyl-1-N,3-N-bis(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide;ethane |
| SMILES | CC.CC(=O)c1cc(C(=O)NCC(O)CO)cc(C(=O)NCC(O)CO)c1 |
| InChI | InChI=1S/C16H22N2O7.C2H6/c1-9(21)10-2-11(15(24)17-5-13(22)7-19)4-12(3-10)16(25)18-6-14(23)8-20;1-2/h2-4,13-14,19-20,22-23H,5-8H2,1H3,(H,17,24)(H,18,25);1-2H3 |
| InChIKey | KDIMYQYKTHAJTH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |