C13H19NO3 — CID 172511882
N-[(2S)-2,3-dihydroxypropyl]-3-propan-2-ylbenzamide (PubChem CID 172511882) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropyl]-3-propan-2-ylbenzamide.
| Compound Name | N-[(2S)-2,3-dihydroxypropyl]-3-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 172511882 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropyl]-3-propan-2-ylbenzamide |
| SMILES | CC(C)c1cccc(C(=O)NC[C@H](O)CO)c1 |
| InChI | InChI=1S/C13H19NO3/c1-9(2)10-4-3-5-11(6-10)13(17)14-7-12(16)8-15/h3-6,9,12,15-16H,7-8H2,1-2H3,(H,14,17)/t12-/m0/s1 |
| InChIKey | KHHWDPDCVNJOHO-LBPRGKRZSA-N |
| XLogP | 0.89 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |