C11H15NO3 — CID 40653428
N-[(2S)-2,3-dihydroxypropyl]-3-methylbenzamide (PubChem CID 40653428) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropyl]-3-methylbenzamide.
| Compound Name | N-[(2S)-2,3-dihydroxypropyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 40653428 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC[C@H](O)CO)c1 |
| InChI | InChI=1S/C11H15NO3/c1-8-3-2-4-9(5-8)11(15)12-6-10(14)7-13/h2-5,10,13-14H,6-7H2,1H3,(H,12,15)/t10-/m0/s1 |
| InChIKey | RUOUWEBNJHZFMN-JTQLQIEISA-N |
| XLogP | 0.08 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |