C15H19N3O7 — CID 169352877
1-N,3-N-bis(2,3-dihydroxypropyl)-5-isocyanatobenzene-1,3-dicarboxamide (PubChem CID 169352877) has the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. Its IUPAC name is 1-N,3-N-bis(2,3-dihydroxypropyl)-5-isocyanatobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-isocyanatobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 169352877 |
| Molecular Formula | C15H19N3O7 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-isocyanatobenzene-1,3-dicarboxamide |
| SMILES | O=C=Nc1cc(C(=O)NCC(O)CO)cc(C(=O)NCC(O)CO)c1 |
| InChI | InChI=1S/C15H19N3O7/c19-6-12(22)4-16-14(24)9-1-10(3-11(2-9)18-8-21)15(25)17-5-13(23)7-20/h1-3,12-13,19-20,22-23H,4-7H2,(H,16,24)(H,17,25) |
| InChIKey | SEMPUZSISHLMST-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 168.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|