C9H13NO4 — CID 114821790
N-(2,3-dihydroxypropyl)-5-methylfuran-3-carboxamide (PubChem CID 114821790) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-5-methylfuran-3-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 114821790 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-5-methylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(O)CO)co1 |
| InChI | InChI=1S/C9H13NO4/c1-6-2-7(5-14-6)9(13)10-3-8(12)4-11/h2,5,8,11-12H,3-4H2,1H3,(H,10,13) |
| InChIKey | ZNMGFWVXEZSCLM-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |