C15H23NO3 — CID 66176629
N-(2,3-dihydroxypropyl)-2,3,4,5,6-pentamethylbenzamide (PubChem CID 66176629) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2,3,4,5,6-pentamethylbenzamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2,3,4,5,6-pentamethylbenzamide |
|---|---|
| PubChem CID | 66176629 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2,3,4,5,6-pentamethylbenzamide |
| SMILES | Cc1c(C)c(C)c(C(=O)NCC(O)CO)c(C)c1C |
| InChI | InChI=1S/C15H23NO3/c1-8-9(2)11(4)14(12(5)10(8)3)15(19)16-6-13(18)7-17/h13,17-18H,6-7H2,1-5H3,(H,16,19) |
| InChIKey | FUBRIGJXCBKMNO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |